C19H13Cl2F4N — CID 147994304
4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-2-ethynyl-N-methylaniline (PubChem CID 147994304) has the molecular formula C19H13Cl2F4N and a molecular weight of 402.22 g/mol. Its IUPAC name is 4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-2-ethynyl-N-methylaniline.
| Compound Name | 4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-2-ethynyl-N-methylaniline |
|---|---|
| PubChem CID | 147994304 |
| Molecular Formula | C19H13Cl2F4N |
| Molecular Weight | 402.22 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-2-ethynyl-N-methylaniline |
| SMILES | C#Cc1cc(/C=C/C(c2cc(Cl)c(F)c(Cl)c2)C(F)(F)F)ccc1NC |
| InChI | InChI=1S/C19H13Cl2F4N/c1-3-12-8-11(5-7-17(12)26-2)4-6-14(19(23,24)25)13-9-15(20)18(22)16(21)10-13/h1,4-10,14,26H,2H3/b6-4+ |
| InChIKey | IVRSKAYSVXVTKB-GQCTYLIASA-N |
| XLogP | 6.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.22 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|