C23H27ClF3N2+ — CID 163611037
5-[(E)-3-(3-chloro-4,5-dimethylphenyl)-4,4,4-trifluorobut-1-enyl]-N-methyl-2-[(1-methylaziridin-1-ium-1-yl)methyl]aniline (PubChem CID 163611037) has the molecular formula C23H27ClF3N2+ and a molecular weight of 423.93 g/mol. Its IUPAC name is 5-[(E)-3-(3-chloro-4,5-dimethylphenyl)-4,4,4-trifluorobut-1-enyl]-N-methyl-2-[(1-methylaziridin-1-ium-1-yl)methyl]aniline.
| Compound Name | 5-[(E)-3-(3-chloro-4,5-dimethylphenyl)-4,4,4-trifluorobut-1-enyl]-N-methyl-2-[(1-methylaziridin-1-ium-1-yl)methyl]aniline |
|---|---|
| PubChem CID | 163611037 |
| Molecular Formula | C23H27ClF3N2+ |
| Molecular Weight | 423.93 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 5-[(E)-3-(3-chloro-4,5-dimethylphenyl)-4,4,4-trifluorobut-1-enyl]-N-methyl-2-[(1-methylaziridin-1-ium-1-yl)methyl]aniline |
| SMILES | CNc1cc(/C=C/C(c2cc(C)c(C)c(Cl)c2)C(F)(F)F)ccc1C[N+]1(C)CC1 |
| InChI | InChI=1S/C23H27ClF3N2/c1-15-11-19(13-21(24)16(15)2)20(23(25,26)27)8-6-17-5-7-18(22(12-17)28-3)14-29(4)9-10-29/h5-8,11-13,20,28H,9-10,14H2,1-4H3/q+1/b8-6+ |
| InChIKey | COPCIVVQIYCFKI-SOFGYWHQSA-N |
| XLogP | 6.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.93 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|