C20H18ClF3O — CID 134225442
4-[(E)-3-(4-chloro-3,5-dimethylphenyl)-4,4,4-trifluorobut-1-enyl]-2-methylbenzaldehyde (PubChem CID 134225442) has the molecular formula C20H18ClF3O and a molecular weight of 366.81 g/mol. Its IUPAC name is 4-[(E)-3-(4-chloro-3,5-dimethylphenyl)-4,4,4-trifluorobut-1-enyl]-2-methylbenzaldehyde.
| Compound Name | 4-[(E)-3-(4-chloro-3,5-dimethylphenyl)-4,4,4-trifluorobut-1-enyl]-2-methylbenzaldehyde |
|---|---|
| PubChem CID | 134225442 |
| Molecular Formula | C20H18ClF3O |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 4-[(E)-3-(4-chloro-3,5-dimethylphenyl)-4,4,4-trifluorobut-1-enyl]-2-methylbenzaldehyde |
| SMILES | Cc1cc(/C=C/C(c2cc(C)c(Cl)c(C)c2)C(F)(F)F)ccc1C=O |
| InChI | InChI=1S/C20H18ClF3O/c1-12-8-15(4-6-16(12)11-25)5-7-18(20(22,23)24)17-9-13(2)19(21)14(3)10-17/h4-11,18H,1-3H3/b7-5+ |
| InChIKey | IAVGWJADBLAPSM-FNORWQNLSA-N |
| XLogP | 6.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|