C16H7Cl2F3O — CID 631177
1,3-dichloro-6-(trifluoromethyl)phenanthrene-9-carbaldehyde (PubChem CID 631177) has the molecular formula C16H7Cl2F3O and a molecular weight of 343.13 g/mol. Its IUPAC name is 1,3-dichloro-6-(trifluoromethyl)phenanthrene-9-carbaldehyde.
| Compound Name | 1,3-dichloro-6-(trifluoromethyl)phenanthrene-9-carbaldehyde |
|---|---|
| PubChem CID | 631177 |
| Molecular Formula | C16H7Cl2F3O |
| Molecular Weight | 343.13 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | 1,3-dichloro-6-(trifluoromethyl)phenanthrene-9-carbaldehyde |
| SMILES | O=Cc1cc2c(Cl)cc(Cl)cc2c2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C16H7Cl2F3O/c17-10-5-13-12-4-9(16(19,20)21)1-2-11(12)8(7-22)3-14(13)15(18)6-10/h1-7H |
| InChIKey | ZBUKGLLJDMRAAF-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.13 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|