About 2-[(4-tert-butylphenyl)methoxy]-3,5-dichlorobenzaldehyde
2-[(4-tert-butylphenyl)methoxy]-3,5-dichlorobenzaldehyde (PubChem CID 129323176) has the molecular formula C18H18Cl2O2
and a molecular weight of 337.25 g/mol. Its IUPAC name is 2-[(4-tert-butylphenyl)methoxy]-3,5-dichlorobenzaldehyde.
Molecular Properties
| Compound Name | 2-[(4-tert-butylphenyl)methoxy]-3,5-dichlorobenzaldehyde |
| PubChem CID | 129323176 |
| Molecular Formula | C18H18Cl2O2 |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 2-[(4-tert-butylphenyl)methoxy]-3,5-dichlorobenzaldehyde |
| SMILES | CC(C)(C)c1ccc(COc2c(Cl)cc(Cl)cc2C=O)cc1 |
| InChI | InChI=1S/C18H18Cl2O2/c1-18(2,3)14-6-4-12(5-7-14)11-22-17-13(10-21)8-15(19)9-16(17)20/h4-10H,11H2,1-3H3 |
| InChIKey | KBFBYOYADCFJDD-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-tert-butylphenyl)methoxy]-3,5-dichlorobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-tert-butylphenyl)methoxy]-3,5-dichlorobenzaldehyde?
The IUPAC name of 2-[(4-tert-butylphenyl)methoxy]-3,5-dichlorobenzaldehyde (CID 129323176) is 2-[(4-tert-butylphenyl)methoxy]-3,5-dichlorobenzaldehyde.
What is the SMILES notation for 2-[(4-tert-butylphenyl)methoxy]-3,5-dichlorobenzaldehyde?
The canonical SMILES for 2-[(4-tert-butylphenyl)methoxy]-3,5-dichlorobenzaldehyde is CC(C)(C)c1ccc(COc2c(Cl)cc(Cl)cc2C=O)cc1.
What is the InChIKey of 2-[(4-tert-butylphenyl)methoxy]-3,5-dichlorobenzaldehyde?
The InChIKey is KBFBYOYADCFJDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18Cl2O2/c1-18(2,3)14-6-4-12(5-7-14)11-22-17-13(10-21)8-15(19)9-16(17)20/h4-10H,11H2,1-3H3.
What are the key properties of 2-[(4-tert-butylphenyl)methoxy]-3,5-dichlorobenzaldehyde?
2-[(4-tert-butylphenyl)methoxy]-3,5-dichlorobenzaldehyde has a molecular weight of 337.25 g/mol, XLogP of 5.68, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-tert-butylphenyl)methoxy]-3,5-dichlorobenzaldehyde is sourced from PubChem (CID 129323176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).