About 5-[(2,4-dichloro-6-formylphenoxy)methyl]-2-fluorobenzonitrile
5-[(2,4-dichloro-6-formylphenoxy)methyl]-2-fluorobenzonitrile (PubChem CID 107881556) has the molecular formula C15H8Cl2FNO2
and a molecular weight of 324.14 g/mol. Its IUPAC name is 5-[(2,4-dichloro-6-formylphenoxy)methyl]-2-fluorobenzonitrile.
Molecular Properties
| Compound Name | 5-[(2,4-dichloro-6-formylphenoxy)methyl]-2-fluorobenzonitrile |
| PubChem CID | 107881556 |
| Molecular Formula | C15H8Cl2FNO2 |
| Molecular Weight | 324.14 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | 5-[(2,4-dichloro-6-formylphenoxy)methyl]-2-fluorobenzonitrile |
| SMILES | N#Cc1cc(COc2c(Cl)cc(Cl)cc2C=O)ccc1F |
| InChI | InChI=1S/C15H8Cl2FNO2/c16-12-4-11(7-20)15(13(17)5-12)21-8-9-1-2-14(18)10(3-9)6-19/h1-5,7H,8H2 |
| InChIKey | QLRRCSSKRFTXCE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.14 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2,4-dichloro-6-formylphenoxy)methyl]-2-fluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,4-dichloro-6-formylphenoxy)methyl]-2-fluorobenzonitrile?
The IUPAC name of 5-[(2,4-dichloro-6-formylphenoxy)methyl]-2-fluorobenzonitrile (CID 107881556) is 5-[(2,4-dichloro-6-formylphenoxy)methyl]-2-fluorobenzonitrile.
What is the SMILES notation for 5-[(2,4-dichloro-6-formylphenoxy)methyl]-2-fluorobenzonitrile?
The canonical SMILES for 5-[(2,4-dichloro-6-formylphenoxy)methyl]-2-fluorobenzonitrile is N#Cc1cc(COc2c(Cl)cc(Cl)cc2C=O)ccc1F.
What is the InChIKey of 5-[(2,4-dichloro-6-formylphenoxy)methyl]-2-fluorobenzonitrile?
The InChIKey is QLRRCSSKRFTXCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8Cl2FNO2/c16-12-4-11(7-20)15(13(17)5-12)21-8-9-1-2-14(18)10(3-9)6-19/h1-5,7H,8H2.
What are the key properties of 5-[(2,4-dichloro-6-formylphenoxy)methyl]-2-fluorobenzonitrile?
5-[(2,4-dichloro-6-formylphenoxy)methyl]-2-fluorobenzonitrile has a molecular weight of 324.14 g/mol, XLogP of 4.40, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,4-dichloro-6-formylphenoxy)methyl]-2-fluorobenzonitrile is sourced from PubChem (CID 107881556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).