C15H12Cl2O3 — CID 102939681
3,5-dichloro-2-(phenylmethoxymethoxy)benzaldehyde (PubChem CID 102939681) has the molecular formula C15H12Cl2O3 and a molecular weight of 311.16 g/mol. Its IUPAC name is 3,5-dichloro-2-(phenylmethoxymethoxy)benzaldehyde.
| Compound Name | 3,5-dichloro-2-(phenylmethoxymethoxy)benzaldehyde |
|---|---|
| PubChem CID | 102939681 |
| Molecular Formula | C15H12Cl2O3 |
| Molecular Weight | 311.16 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 3,5-dichloro-2-(phenylmethoxymethoxy)benzaldehyde |
| SMILES | O=Cc1cc(Cl)cc(Cl)c1OCOCc1ccccc1 |
| InChI | InChI=1S/C15H12Cl2O3/c16-13-6-12(8-18)15(14(17)7-13)20-10-19-9-11-4-2-1-3-5-11/h1-8H,9-10H2 |
| InChIKey | IJGPOVTUYSZQFQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.16 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|