C22H25ClO3 — CID 19930257
5-chloro-2-(8-phenyloctoxy)benzene-1,3-dicarbaldehyde (PubChem CID 19930257) has the molecular formula C22H25ClO3 and a molecular weight of 372.89 g/mol. Its IUPAC name is 5-chloro-2-(8-phenyloctoxy)benzene-1,3-dicarbaldehyde.
| Compound Name | 5-chloro-2-(8-phenyloctoxy)benzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 19930257 |
| Molecular Formula | C22H25ClO3 |
| Molecular Weight | 372.89 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 5-chloro-2-(8-phenyloctoxy)benzene-1,3-dicarbaldehyde |
| SMILES | O=Cc1cc(Cl)cc(C=O)c1OCCCCCCCCc1ccccc1 |
| InChI | InChI=1S/C22H25ClO3/c23-21-14-19(16-24)22(20(15-21)17-25)26-13-9-4-2-1-3-6-10-18-11-7-5-8-12-18/h5,7-8,11-12,14-17H,1-4,6,9-10,13H2 |
| InChIKey | OKIZNKKSZLGWEK-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.89 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|