C24H30O3 — CID 19930286
5-methyl-2-[8-(4-methylphenyl)octoxy]benzene-1,3-dicarbaldehyde (PubChem CID 19930286) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is 5-methyl-2-[8-(4-methylphenyl)octoxy]benzene-1,3-dicarbaldehyde.
| Compound Name | 5-methyl-2-[8-(4-methylphenyl)octoxy]benzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 19930286 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 5-methyl-2-[8-(4-methylphenyl)octoxy]benzene-1,3-dicarbaldehyde |
| SMILES | Cc1ccc(CCCCCCCCOc2c(C=O)cc(C)cc2C=O)cc1 |
| InChI | InChI=1S/C24H30O3/c1-19-10-12-21(13-11-19)9-7-5-3-4-6-8-14-27-24-22(17-25)15-20(2)16-23(24)18-26/h10-13,15-18H,3-9,14H2,1-2H3 |
| InChIKey | YQDCBSRKFKGHBD-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|