C18H20O3 — CID 43366508
3-ethoxy-2-(3-phenylpropoxy)benzaldehyde (PubChem CID 43366508) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is 3-ethoxy-2-(3-phenylpropoxy)benzaldehyde.
| Compound Name | 3-ethoxy-2-(3-phenylpropoxy)benzaldehyde |
|---|---|
| PubChem CID | 43366508 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 3-ethoxy-2-(3-phenylpropoxy)benzaldehyde |
| SMILES | CCOc1cccc(C=O)c1OCCCc1ccccc1 |
| InChI | InChI=1S/C18H20O3/c1-2-20-17-12-6-11-16(14-19)18(17)21-13-7-10-15-8-4-3-5-9-15/h3-6,8-9,11-12,14H,2,7,10,13H2,1H3 |
| InChIKey | HSFULIAXQBCKTQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|