C14H17F3O4 — CID 61491424
3-ethoxy-2-[3-(2,2,2-trifluoroethoxy)propoxy]benzaldehyde (PubChem CID 61491424) has the molecular formula C14H17F3O4 and a molecular weight of 306.28 g/mol. Its IUPAC name is 3-ethoxy-2-[3-(2,2,2-trifluoroethoxy)propoxy]benzaldehyde.
| Compound Name | 3-ethoxy-2-[3-(2,2,2-trifluoroethoxy)propoxy]benzaldehyde |
|---|---|
| PubChem CID | 61491424 |
| Molecular Formula | C14H17F3O4 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 3-ethoxy-2-[3-(2,2,2-trifluoroethoxy)propoxy]benzaldehyde |
| SMILES | CCOc1cccc(C=O)c1OCCCOCC(F)(F)F |
| InChI | InChI=1S/C14H17F3O4/c1-2-20-12-6-3-5-11(9-18)13(12)21-8-4-7-19-10-14(15,16)17/h3,5-6,9H,2,4,7-8,10H2,1H3 |
| InChIKey | PJOSARFDJLJUEG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|