C14H18O5 — CID 79624513
3-(2-ethoxy-6-formylphenoxy)-2,2-dimethylpropanoic acid (PubChem CID 79624513) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is 3-(2-ethoxy-6-formylphenoxy)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(2-ethoxy-6-formylphenoxy)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 79624513 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 3-(2-ethoxy-6-formylphenoxy)-2,2-dimethylpropanoic acid |
| SMILES | CCOc1cccc(C=O)c1OCC(C)(C)C(=O)O |
| InChI | InChI=1S/C14H18O5/c1-4-18-11-7-5-6-10(8-15)12(11)19-9-14(2,3)13(16)17/h5-8H,4,9H2,1-3H3,(H,16,17) |
| InChIKey | UHNMUFKPYINXAU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|