C11H8F6O3 — CID 154667088
2,3-bis(2,2,2-trifluoroethoxy)benzaldehyde (PubChem CID 154667088) has the molecular formula C11H8F6O3 and a molecular weight of 302.17 g/mol. Its IUPAC name is 2,3-bis(2,2,2-trifluoroethoxy)benzaldehyde.
| Compound Name | 2,3-bis(2,2,2-trifluoroethoxy)benzaldehyde |
|---|---|
| PubChem CID | 154667088 |
| Molecular Formula | C11H8F6O3 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 2,3-bis(2,2,2-trifluoroethoxy)benzaldehyde |
| SMILES | O=Cc1cccc(OCC(F)(F)F)c1OCC(F)(F)F |
| InChI | InChI=1S/C11H8F6O3/c12-10(13,14)5-19-8-3-1-2-7(4-18)9(8)20-6-11(15,16)17/h1-4H,5-6H2 |
| InChIKey | JNRGUFMGRCISQQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|