C11H9F3O4 — CID 87891614
2,2,2-trifluoroethyl 2-(2-formylphenoxy)acetate (PubChem CID 87891614) has the molecular formula C11H9F3O4 and a molecular weight of 262.18 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-(2-formylphenoxy)acetate.
| Compound Name | 2,2,2-trifluoroethyl 2-(2-formylphenoxy)acetate |
|---|---|
| PubChem CID | 87891614 |
| Molecular Formula | C11H9F3O4 |
| Molecular Weight | 262.18 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-(2-formylphenoxy)acetate |
| SMILES | O=Cc1ccccc1OCC(=O)OCC(F)(F)F |
| InChI | InChI=1S/C11H9F3O4/c12-11(13,14)7-18-10(16)6-17-9-4-2-1-3-8(9)5-15/h1-5H,6-7H2 |
| InChIKey | KPUWVDAMWNVXAR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.18 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|