[2-(2,5-dichlorophenyl)-2-oxoethyl] 2-(2-formylphenoxy)acetate

C17H12Cl2O5 — CID 23760901

IUPAC[2-(2,5-dichlorophenyl)-2-oxoethyl] 2-(2-formylphenoxy)acetate
SMILESO=Cc1ccccc1OCC(=O)OCC(=O)c1cc(Cl)ccc1Cl
InChIInChI=1S/C17H12Cl2O5/c18-12-5-6-14(19)13(7-12)15(21)9-24-17(22)10-23-16-4-2-1-3-11(16)8-20/h1-8H,9-10H2
InChIKeyUZZNGSAYTYWZCV-UHFFFAOYSA-N
MW367.18 g/mol
LogP3.61
Rot. Bonds7

About [2-(2,5-dichlorophenyl)-2-oxoethyl] 2-(2-formylphenoxy)acetate

[2-(2,5-dichlorophenyl)-2-oxoethyl] 2-(2-formylphenoxy)acetate (PubChem CID 23760901) has the molecular formula C17H12Cl2O5 and a molecular weight of 367.18 g/mol. Its IUPAC name is [2-(2,5-dichlorophenyl)-2-oxoethyl] 2-(2-formylphenoxy)acetate.

Molecular Properties

Compound Name[2-(2,5-dichlorophenyl)-2-oxoethyl] 2-(2-formylphenoxy)acetate
PubChem CID23760901
Molecular FormulaC17H12Cl2O5
Molecular Weight367.18 g/mol
Exact Mass366.01
IUPAC Name[2-(2,5-dichlorophenyl)-2-oxoethyl] 2-(2-formylphenoxy)acetate
SMILESO=Cc1ccccc1OCC(=O)OCC(=O)c1cc(Cl)ccc1Cl
InChIInChI=1S/C17H12Cl2O5/c18-12-5-6-14(19)13(7-12)15(21)9-24-17(22)10-23-16-4-2-1-3-11(16)8-20/h1-8H,9-10H2
InChIKeyUZZNGSAYTYWZCV-UHFFFAOYSA-N
XLogP3.61
TPSA69.67 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500367.18
LogP ≤ 53.61
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze [2-(2,5-dichlorophenyl)-2-oxoethyl] 2-(2-formylphenoxy)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(2,5-dichlorophenyl)-2-oxoethyl] 2-(2-formylphenoxy)acetate?
The IUPAC name of [2-(2,5-dichlorophenyl)-2-oxoethyl] 2-(2-formylphenoxy)acetate (CID 23760901) is [2-(2,5-dichlorophenyl)-2-oxoethyl] 2-(2-formylphenoxy)acetate.
What is the SMILES notation for [2-(2,5-dichlorophenyl)-2-oxoethyl] 2-(2-formylphenoxy)acetate?
The canonical SMILES for [2-(2,5-dichlorophenyl)-2-oxoethyl] 2-(2-formylphenoxy)acetate is O=Cc1ccccc1OCC(=O)OCC(=O)c1cc(Cl)ccc1Cl.
What is the InChIKey of [2-(2,5-dichlorophenyl)-2-oxoethyl] 2-(2-formylphenoxy)acetate?
The InChIKey is UZZNGSAYTYWZCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12Cl2O5/c18-12-5-6-14(19)13(7-12)15(21)9-24-17(22)10-23-16-4-2-1-3-11(16)8-20/h1-8H,9-10H2.
What are the key properties of [2-(2,5-dichlorophenyl)-2-oxoethyl] 2-(2-formylphenoxy)acetate?
[2-(2,5-dichlorophenyl)-2-oxoethyl] 2-(2-formylphenoxy)acetate has a molecular weight of 367.18 g/mol, XLogP of 3.61, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,5-dichlorophenyl)-2-oxoethyl] 2-(2-formylphenoxy)acetate is sourced from PubChem (CID 23760901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).