C17H12Cl2O5 — CID 23760901
[2-(2,5-dichlorophenyl)-2-oxoethyl] 2-(2-formylphenoxy)acetate (PubChem CID 23760901) has the molecular formula C17H12Cl2O5 and a molecular weight of 367.18 g/mol. Its IUPAC name is [2-(2,5-dichlorophenyl)-2-oxoethyl] 2-(2-formylphenoxy)acetate.
| Compound Name | [2-(2,5-dichlorophenyl)-2-oxoethyl] 2-(2-formylphenoxy)acetate |
|---|---|
| PubChem CID | 23760901 |
| Molecular Formula | C17H12Cl2O5 |
| Molecular Weight | 367.18 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | [2-(2,5-dichlorophenyl)-2-oxoethyl] 2-(2-formylphenoxy)acetate |
| SMILES | O=Cc1ccccc1OCC(=O)OCC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H12Cl2O5/c18-12-5-6-14(19)13(7-12)15(21)9-24-17(22)10-23-16-4-2-1-3-11(16)8-20/h1-8H,9-10H2 |
| InChIKey | UZZNGSAYTYWZCV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.18 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|