C19H17Cl2NO5 — CID 8608301
[2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-(2-formylphenoxy)acetate (PubChem CID 8608301) has the molecular formula C19H17Cl2NO5 and a molecular weight of 410.25 g/mol. Its IUPAC name is [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-(2-formylphenoxy)acetate.
| Compound Name | [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-(2-formylphenoxy)acetate |
|---|---|
| PubChem CID | 8608301 |
| Molecular Formula | C19H17Cl2NO5 |
| Molecular Weight | 410.25 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-(2-formylphenoxy)acetate |
| SMILES | O=Cc1ccccc1OCC(=O)OCC(=O)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H17Cl2NO5/c20-15-6-5-13(16(21)9-15)7-8-22-18(24)11-27-19(25)12-26-17-4-2-1-3-14(17)10-23/h1-6,9-10H,7-8,11-12H2,(H,22,24) |
| InChIKey | HMSGCDFHDURUHO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.25 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|