C12H11ClN2O3 — CID 39050836
2-(4-chloro-2-formylphenoxy)-N-(2-cyanoethyl)acetamide (PubChem CID 39050836) has the molecular formula C12H11ClN2O3 and a molecular weight of 266.68 g/mol. Its IUPAC name is 2-(4-chloro-2-formylphenoxy)-N-(2-cyanoethyl)acetamide.
| Compound Name | 2-(4-chloro-2-formylphenoxy)-N-(2-cyanoethyl)acetamide |
|---|---|
| PubChem CID | 39050836 |
| Molecular Formula | C12H11ClN2O3 |
| Molecular Weight | 266.68 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 2-(4-chloro-2-formylphenoxy)-N-(2-cyanoethyl)acetamide |
| SMILES | N#CCCNC(=O)COc1ccc(Cl)cc1C=O |
| InChI | InChI=1S/C12H11ClN2O3/c13-10-2-3-11(9(6-10)7-16)18-8-12(17)15-5-1-4-14/h2-3,6-7H,1,5,8H2,(H,15,17) |
| InChIKey | ZUJLKFMVHXEOGC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.68 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|