C12H12N2O4 — CID 43267879
N-(cyanomethyl)-2-(2-formyl-4-methoxyphenoxy)acetamide (PubChem CID 43267879) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is N-(cyanomethyl)-2-(2-formyl-4-methoxyphenoxy)acetamide.
| Compound Name | N-(cyanomethyl)-2-(2-formyl-4-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 43267879 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | N-(cyanomethyl)-2-(2-formyl-4-methoxyphenoxy)acetamide |
| SMILES | COc1ccc(OCC(=O)NCC#N)c(C=O)c1 |
| InChI | InChI=1S/C12H12N2O4/c1-17-10-2-3-11(9(6-10)7-15)18-8-12(16)14-5-4-13/h2-3,6-7H,5,8H2,1H3,(H,14,16) |
| InChIKey | MNFAYJYMNKFDOY-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|