C18H19NO4S — CID 8869062
2-(2-formyl-4-methoxyphenoxy)-N-(2-phenylsulfanylethyl)acetamide (PubChem CID 8869062) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is 2-(2-formyl-4-methoxyphenoxy)-N-(2-phenylsulfanylethyl)acetamide.
| Compound Name | 2-(2-formyl-4-methoxyphenoxy)-N-(2-phenylsulfanylethyl)acetamide |
|---|---|
| PubChem CID | 8869062 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 2-(2-formyl-4-methoxyphenoxy)-N-(2-phenylsulfanylethyl)acetamide |
| SMILES | COc1ccc(OCC(=O)NCCSc2ccccc2)c(C=O)c1 |
| InChI | InChI=1S/C18H19NO4S/c1-22-15-7-8-17(14(11-15)12-20)23-13-18(21)19-9-10-24-16-5-3-2-4-6-16/h2-8,11-12H,9-10,13H2,1H3,(H,19,21) |
| InChIKey | BUPQGXHKQDNZBA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|