C18H19NO5 — CID 8633789
2-(2-formyl-4-methoxyphenoxy)-N-[(3-methoxyphenyl)methyl]acetamide (PubChem CID 8633789) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is 2-(2-formyl-4-methoxyphenoxy)-N-[(3-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-(2-formyl-4-methoxyphenoxy)-N-[(3-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 8633789 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 2-(2-formyl-4-methoxyphenoxy)-N-[(3-methoxyphenyl)methyl]acetamide |
| SMILES | COc1cccc(CNC(=O)COc2ccc(OC)cc2C=O)c1 |
| InChI | InChI=1S/C18H19NO5/c1-22-15-5-3-4-13(8-15)10-19-18(21)12-24-17-7-6-16(23-2)9-14(17)11-20/h3-9,11H,10,12H2,1-2H3,(H,19,21) |
| InChIKey | JWGKVLOXZMRCDT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|