C19H12Cl2O4 — CID 23010873
(2-formylnaphthalen-1-yl) 2-(2,4-dichlorophenoxy)acetate (PubChem CID 23010873) has the molecular formula C19H12Cl2O4 and a molecular weight of 375.21 g/mol. Its IUPAC name is (2-formylnaphthalen-1-yl) 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | (2-formylnaphthalen-1-yl) 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 23010873 |
| Molecular Formula | C19H12Cl2O4 |
| Molecular Weight | 375.21 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | (2-formylnaphthalen-1-yl) 2-(2,4-dichlorophenoxy)acetate |
| SMILES | O=Cc1ccc2ccccc2c1OC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H12Cl2O4/c20-14-7-8-17(16(21)9-14)24-11-18(23)25-19-13(10-22)6-5-12-3-1-2-4-15(12)19/h1-10H,11H2 |
| InChIKey | CVFOEMWUEYJLCC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.21 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|