C14H8Cl4O4 — CID 57171249
(2,4-dichlorophenyl) 2-(2,4-dichlorophenoxy)ethaneperoxoate (PubChem CID 57171249) has the molecular formula C14H8Cl4O4 and a molecular weight of 382.03 g/mol. Its IUPAC name is (2,4-dichlorophenyl) 2-(2,4-dichlorophenoxy)ethaneperoxoate.
| Compound Name | (2,4-dichlorophenyl) 2-(2,4-dichlorophenoxy)ethaneperoxoate |
|---|---|
| PubChem CID | 57171249 |
| Molecular Formula | C14H8Cl4O4 |
| Molecular Weight | 382.03 g/mol |
| Exact Mass | 379.92 |
| IUPAC Name | (2,4-dichlorophenyl) 2-(2,4-dichlorophenoxy)ethaneperoxoate |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)OOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H8Cl4O4/c15-8-1-3-12(10(17)5-8)20-7-14(19)22-21-13-4-2-9(16)6-11(13)18/h1-6H,7H2 |
| InChIKey | ZXMUSPPUDYVXEV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.03 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|