C12H12Cl2O3 — CID 170555198
2-methylprop-2-enyl 2-(2,4-dichlorophenoxy)acetate (PubChem CID 170555198) has the molecular formula C12H12Cl2O3 and a molecular weight of 275.13 g/mol. Its IUPAC name is 2-methylprop-2-enyl 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | 2-methylprop-2-enyl 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 170555198 |
| Molecular Formula | C12H12Cl2O3 |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 2-methylprop-2-enyl 2-(2,4-dichlorophenoxy)acetate |
| SMILES | C=C(C)COC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H12Cl2O3/c1-8(2)6-17-12(15)7-16-11-4-3-9(13)5-10(11)14/h3-5H,1,6-7H2,2H3 |
| InChIKey | CFFGIWRBLWZIGB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|