C13H13Cl2NO4 — CID 70373402
(1-amino-3-methyl-1-oxobut-3-en-2-yl) 2-(2,4-dichlorophenoxy)acetate (PubChem CID 70373402) has the molecular formula C13H13Cl2NO4 and a molecular weight of 318.16 g/mol. Its IUPAC name is (1-amino-3-methyl-1-oxobut-3-en-2-yl) 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | (1-amino-3-methyl-1-oxobut-3-en-2-yl) 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 70373402 |
| Molecular Formula | C13H13Cl2NO4 |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | (1-amino-3-methyl-1-oxobut-3-en-2-yl) 2-(2,4-dichlorophenoxy)acetate |
| SMILES | C=C(C)C(OC(=O)COc1ccc(Cl)cc1Cl)C(N)=O |
| InChI | InChI=1S/C13H13Cl2NO4/c1-7(2)12(13(16)18)20-11(17)6-19-10-4-3-8(14)5-9(10)15/h3-5,12H,1,6H2,2H3,(H2,16,18) |
| InChIKey | FILXRUYJSLHTDV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|