C11H13Cl2O6P — CID 11361012
1-[2-(2,4-dichlorophenoxy)acetyl]oxyethyl-methoxyphosphinic acid (PubChem CID 11361012) has the molecular formula C11H13Cl2O6P and a molecular weight of 343.10 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenoxy)acetyl]oxyethyl-methoxyphosphinic acid.
| Compound Name | 1-[2-(2,4-dichlorophenoxy)acetyl]oxyethyl-methoxyphosphinic acid |
|---|---|
| PubChem CID | 11361012 |
| Molecular Formula | C11H13Cl2O6P |
| Molecular Weight | 343.10 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | 1-[2-(2,4-dichlorophenoxy)acetyl]oxyethyl-methoxyphosphinic acid |
| SMILES | COP(=O)(O)C(C)OC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H13Cl2O6P/c1-7(20(15,16)17-2)19-11(14)6-18-10-4-3-8(12)5-9(10)13/h3-5,7H,6H2,1-2H3,(H,15,16) |
| InChIKey | OOYYLOYZRMIFDL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.10 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|