C13H12Cl2O3 — CID 98005192
[(2S)-pent-3-yn-2-yl] 2-(2,4-dichlorophenoxy)acetate (PubChem CID 98005192) has the molecular formula C13H12Cl2O3 and a molecular weight of 287.14 g/mol. Its IUPAC name is [(2S)-pent-3-yn-2-yl] 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | [(2S)-pent-3-yn-2-yl] 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 98005192 |
| Molecular Formula | C13H12Cl2O3 |
| Molecular Weight | 287.14 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | [(2S)-pent-3-yn-2-yl] 2-(2,4-dichlorophenoxy)acetate |
| SMILES | CC#C[C@H](C)OC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H12Cl2O3/c1-3-4-9(2)18-13(16)8-17-12-6-5-10(14)7-11(12)15/h5-7,9H,8H2,1-2H3/t9-/m0/s1 |
| InChIKey | OJLCOQBXMNAXFY-VIFPVBQESA-N |
| XLogP | 3.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.14 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|