C15H19Cl2NO4 — CID 932357
[(2R)-1-morpholin-4-ylpropan-2-yl] 2-(2,4-dichlorophenoxy)acetate (PubChem CID 932357) has the molecular formula C15H19Cl2NO4 and a molecular weight of 348.23 g/mol. Its IUPAC name is [(2R)-1-morpholin-4-ylpropan-2-yl] 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | [(2R)-1-morpholin-4-ylpropan-2-yl] 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 932357 |
| Molecular Formula | C15H19Cl2NO4 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | [(2R)-1-morpholin-4-ylpropan-2-yl] 2-(2,4-dichlorophenoxy)acetate |
| SMILES | C[C@H](CN1CCOCC1)OC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H19Cl2NO4/c1-11(9-18-4-6-20-7-5-18)22-15(19)10-21-14-3-2-12(16)8-13(14)17/h2-3,8,11H,4-7,9-10H2,1H3/t11-/m1/s1 |
| InChIKey | OCPGNKKEFBWTNL-LLVKDONJSA-N |
| XLogP | 2.64 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |