C11H15Cl2NO3 — CID 175420675
azane;propan-2-yl 2-(2,4-dichlorophenoxy)acetate (PubChem CID 175420675) has the molecular formula C11H15Cl2NO3 and a molecular weight of 280.15 g/mol. Its IUPAC name is azane;propan-2-yl 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | azane;propan-2-yl 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 175420675 |
| Molecular Formula | C11H15Cl2NO3 |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | azane;propan-2-yl 2-(2,4-dichlorophenoxy)acetate |
| SMILES | CC(C)OC(=O)COc1ccc(Cl)cc1Cl.N |
| InChI | InChI=1S/C11H12Cl2O3.H3N/c1-7(2)16-11(14)6-15-10-4-3-8(12)5-9(10)13;/h3-5,7H,6H2,1-2H3;1H3 |
| InChIKey | LKRGCMVQSXNSOD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 70.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |