C17H17Cl2O7P — CID 11408071
[[2-(2,4-dichlorophenoxy)acetyl]oxy-(4-methoxyphenyl)methyl]-methoxyphosphinic acid (PubChem CID 11408071) has the molecular formula C17H17Cl2O7P and a molecular weight of 435.20 g/mol. Its IUPAC name is [[2-(2,4-dichlorophenoxy)acetyl]oxy-(4-methoxyphenyl)methyl]-methoxyphosphinic acid.
| Compound Name | [[2-(2,4-dichlorophenoxy)acetyl]oxy-(4-methoxyphenyl)methyl]-methoxyphosphinic acid |
|---|---|
| PubChem CID | 11408071 |
| Molecular Formula | C17H17Cl2O7P |
| Molecular Weight | 435.20 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | [[2-(2,4-dichlorophenoxy)acetyl]oxy-(4-methoxyphenyl)methyl]-methoxyphosphinic acid |
| SMILES | COc1ccc(C(OC(=O)COc2ccc(Cl)cc2Cl)P(=O)(O)OC)cc1 |
| InChI | InChI=1S/C17H17Cl2O7P/c1-23-13-6-3-11(4-7-13)17(27(21,22)24-2)26-16(20)10-25-15-8-5-12(18)9-14(15)19/h3-9,17H,10H2,1-2H3,(H,21,22) |
| InChIKey | KDXUWAXNXAMGLX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.20 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|