C16H14Cl2FO6P — CID 11327839
[[2-(2,4-dichlorophenoxy)acetyl]oxy-(4-fluorophenyl)methyl]-methoxyphosphinic acid (PubChem CID 11327839) has the molecular formula C16H14Cl2FO6P and a molecular weight of 423.16 g/mol. Its IUPAC name is [[2-(2,4-dichlorophenoxy)acetyl]oxy-(4-fluorophenyl)methyl]-methoxyphosphinic acid.
| Compound Name | [[2-(2,4-dichlorophenoxy)acetyl]oxy-(4-fluorophenyl)methyl]-methoxyphosphinic acid |
|---|---|
| PubChem CID | 11327839 |
| Molecular Formula | C16H14Cl2FO6P |
| Molecular Weight | 423.16 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | [[2-(2,4-dichlorophenoxy)acetyl]oxy-(4-fluorophenyl)methyl]-methoxyphosphinic acid |
| SMILES | COP(=O)(O)C(OC(=O)COc1ccc(Cl)cc1Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H14Cl2FO6P/c1-23-26(21,22)16(10-2-5-12(19)6-3-10)25-15(20)9-24-14-7-4-11(17)8-13(14)18/h2-8,16H,9H2,1H3,(H,21,22) |
| InChIKey | UXIVLMXEVWDSPG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.16 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|