C10H10Cl2NaO6P — CID 23664115
sodium [2-(2,4-dichlorophenoxy)acetyl]oxymethyl-methoxyphosphinate (PubChem CID 23664115) has the molecular formula C10H10Cl2NaO6P and a molecular weight of 351.05 g/mol. Its IUPAC name is sodium [2-(2,4-dichlorophenoxy)acetyl]oxymethyl-methoxyphosphinate.
| Compound Name | sodium [2-(2,4-dichlorophenoxy)acetyl]oxymethyl-methoxyphosphinate |
|---|---|
| PubChem CID | 23664115 |
| Molecular Formula | C10H10Cl2NaO6P |
| Molecular Weight | 351.05 g/mol |
| Exact Mass | 349.95 |
| IUPAC Name | sodium [2-(2,4-dichlorophenoxy)acetyl]oxymethyl-methoxyphosphinate |
| SMILES | COP(=O)([O-])COC(=O)COc1ccc(Cl)cc1Cl.[Na+] |
| InChI | InChI=1S/C10H11Cl2O6P.Na/c1-16-19(14,15)6-18-10(13)5-17-9-3-2-7(11)4-8(9)12;/h2-4H,5-6H2,1H3,(H,14,15);/q;+1/p-1 |
| InChIKey | SWJWXKOCBUESGR-UHFFFAOYSA-M |
| XLogP | -0.92 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.05 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|