C11H12Cl2LiO6P — CID 72697263
lithium 1-[2-(2,4-dichlorophenoxy)acetyl]oxypropyl-hydroxyphosphinate (PubChem CID 72697263) has the molecular formula C11H12Cl2LiO6P and a molecular weight of 349.03 g/mol. Its IUPAC name is lithium 1-[2-(2,4-dichlorophenoxy)acetyl]oxypropyl-hydroxyphosphinate.
| Compound Name | lithium 1-[2-(2,4-dichlorophenoxy)acetyl]oxypropyl-hydroxyphosphinate |
|---|---|
| PubChem CID | 72697263 |
| Molecular Formula | C11H12Cl2LiO6P |
| Molecular Weight | 349.03 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | lithium 1-[2-(2,4-dichlorophenoxy)acetyl]oxypropyl-hydroxyphosphinate |
| SMILES | CCC(OC(=O)COc1ccc(Cl)cc1Cl)P(=O)([O-])O.[Li+] |
| InChI | InChI=1S/C11H13Cl2O6P.Li/c1-2-11(20(15,16)17)19-10(14)6-18-9-4-3-7(12)5-8(9)13;/h3-5,11H,2,6H2,1H3,(H2,15,16,17);/q;+1/p-1 |
| InChIKey | QAKLWIJMZGKWMU-UHFFFAOYSA-M |
| XLogP | -0.80 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.03 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|