C14H20ClO6P — CID 71724179
1-[2-(4-chloro-2-methylphenoxy)acetyl]oxypentylphosphonic acid (PubChem CID 71724179) has the molecular formula C14H20ClO6P and a molecular weight of 350.74 g/mol. Its IUPAC name is 1-[2-(4-chloro-2-methylphenoxy)acetyl]oxypentylphosphonic acid.
| Compound Name | 1-[2-(4-chloro-2-methylphenoxy)acetyl]oxypentylphosphonic acid |
|---|---|
| PubChem CID | 71724179 |
| Molecular Formula | C14H20ClO6P |
| Molecular Weight | 350.74 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 1-[2-(4-chloro-2-methylphenoxy)acetyl]oxypentylphosphonic acid |
| SMILES | CCCCC(OC(=O)COc1ccc(Cl)cc1C)P(=O)(O)O |
| InChI | InChI=1S/C14H20ClO6P/c1-3-4-5-14(22(17,18)19)21-13(16)9-20-12-7-6-11(15)8-10(12)2/h6-8,14H,3-5,9H2,1-2H3,(H2,17,18,19) |
| InChIKey | RMRXKCNHBPWBOX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.74 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|