C16H13Cl3NaO6P — CID 23676466
sodium [(4-chlorophenyl)-[2-(2,4-dichlorophenoxy)acetyl]oxymethyl]-methoxyphosphinate (PubChem CID 23676466) has the molecular formula C16H13Cl3NaO6P and a molecular weight of 461.60 g/mol. Its IUPAC name is sodium [(4-chlorophenyl)-[2-(2,4-dichlorophenoxy)acetyl]oxymethyl]-methoxyphosphinate.
| Compound Name | sodium [(4-chlorophenyl)-[2-(2,4-dichlorophenoxy)acetyl]oxymethyl]-methoxyphosphinate |
|---|---|
| PubChem CID | 23676466 |
| Molecular Formula | C16H13Cl3NaO6P |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 459.94 |
| IUPAC Name | sodium [(4-chlorophenyl)-[2-(2,4-dichlorophenoxy)acetyl]oxymethyl]-methoxyphosphinate |
| SMILES | COP(=O)([O-])C(OC(=O)COc1ccc(Cl)cc1Cl)c1ccc(Cl)cc1.[Na+] |
| InChI | InChI=1S/C16H14Cl3O6P.Na/c1-23-26(21,22)16(10-2-4-11(17)5-3-10)25-15(20)9-24-14-7-6-12(18)8-13(14)19;/h2-8,16H,9H2,1H3,(H,21,22);/q;+1/p-1 |
| InChIKey | IWADHQWYSFHGJS-UHFFFAOYSA-M |
| XLogP | 1.47 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|