C22H28Cl2NO6P — CID 57328666
2-(2,4-dichlorophenoxy)-N-[dipropoxyphosphoryl-(4-methoxyphenyl)methyl]acetamide (PubChem CID 57328666) has the molecular formula C22H28Cl2NO6P and a molecular weight of 504.35 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[dipropoxyphosphoryl-(4-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[dipropoxyphosphoryl-(4-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 57328666 |
| Molecular Formula | C22H28Cl2NO6P |
| Molecular Weight | 504.35 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[dipropoxyphosphoryl-(4-methoxyphenyl)methyl]acetamide |
| SMILES | CCCOP(=O)(OCCC)C(NC(=O)COc1ccc(Cl)cc1Cl)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H28Cl2NO6P/c1-4-12-30-32(27,31-13-5-2)22(16-6-9-18(28-3)10-7-16)25-21(26)15-29-20-11-8-17(23)14-19(20)24/h6-11,14,22H,4-5,12-13,15H2,1-3H3,(H,25,26) |
| InChIKey | PCMUBGUVLWETIV-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.35 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|