C21H26Cl2NO5P — CID 3663558
2-(2,4-dichlorophenoxy)-N-[dipropoxyphosphoryl(phenyl)methyl]acetamide (PubChem CID 3663558) has the molecular formula C21H26Cl2NO5P and a molecular weight of 474.32 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[dipropoxyphosphoryl(phenyl)methyl]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[dipropoxyphosphoryl(phenyl)methyl]acetamide |
|---|---|
| PubChem CID | 3663558 |
| Molecular Formula | C21H26Cl2NO5P |
| Molecular Weight | 474.32 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[dipropoxyphosphoryl(phenyl)methyl]acetamide |
| SMILES | CCCOP(=O)(OCCC)C(NC(=O)COc1ccc(Cl)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C21H26Cl2NO5P/c1-3-12-28-30(26,29-13-4-2)21(16-8-6-5-7-9-16)24-20(25)15-27-19-11-10-17(22)14-18(19)23/h5-11,14,21H,3-4,12-13,15H2,1-2H3,(H,24,25) |
| InChIKey | TUAFMMJKSBFGJP-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.32 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|