C14H17Cl2NO6S — CID 108755232
2-[[2-(2,4-dichlorophenoxy)acetyl]amino]-4-ethylsulfonylbutanoic acid (PubChem CID 108755232) has the molecular formula C14H17Cl2NO6S and a molecular weight of 398.26 g/mol. Its IUPAC name is 2-[[2-(2,4-dichlorophenoxy)acetyl]amino]-4-ethylsulfonylbutanoic acid.
| Compound Name | 2-[[2-(2,4-dichlorophenoxy)acetyl]amino]-4-ethylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 108755232 |
| Molecular Formula | C14H17Cl2NO6S |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | 2-[[2-(2,4-dichlorophenoxy)acetyl]amino]-4-ethylsulfonylbutanoic acid |
| SMILES | CCS(=O)(=O)CCC(NC(=O)COc1ccc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C14H17Cl2NO6S/c1-2-24(21,22)6-5-11(14(19)20)17-13(18)8-23-12-4-3-9(15)7-10(12)16/h3-4,7,11H,2,5-6,8H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | FJEZEFPYIVZJHZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |