C11H11Cl2NO4S — CID 22217276
(2R)-2-[[2-(2,4-dichlorophenoxy)acetyl]amino]-3-sulfanylpropanoic acid (PubChem CID 22217276) has the molecular formula C11H11Cl2NO4S and a molecular weight of 324.19 g/mol. Its IUPAC name is (2R)-2-[[2-(2,4-dichlorophenoxy)acetyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[2-(2,4-dichlorophenoxy)acetyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 22217276 |
| Molecular Formula | C11H11Cl2NO4S |
| Molecular Weight | 324.19 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | (2R)-2-[[2-(2,4-dichlorophenoxy)acetyl]amino]-3-sulfanylpropanoic acid |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C11H11Cl2NO4S/c12-6-1-2-9(7(13)3-6)18-4-10(15)14-8(5-19)11(16)17/h1-3,8,19H,4-5H2,(H,14,15)(H,16,17)/t8-/m0/s1 |
| InChIKey | OGQRPYPRDBPVJC-QMMMGPOBSA-N |
| XLogP | 1.87 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.19 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|