C11H11Cl2NO5 — CID 595733
2-[[2-(2,4-dichlorophenoxy)acetyl]amino]-3-hydroxypropanoic acid (PubChem CID 595733) has the molecular formula C11H11Cl2NO5 and a molecular weight of 308.12 g/mol. Its IUPAC name is 2-[[2-(2,4-dichlorophenoxy)acetyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[2-(2,4-dichlorophenoxy)acetyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 595733 |
| Molecular Formula | C11H11Cl2NO5 |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | 2-[[2-(2,4-dichlorophenoxy)acetyl]amino]-3-hydroxypropanoic acid |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NC(CO)C(=O)O |
| InChI | InChI=1S/C11H11Cl2NO5/c12-6-1-2-9(7(13)3-6)19-5-10(16)14-8(4-15)11(17)18/h1-3,8,15H,4-5H2,(H,14,16)(H,17,18) |
| InChIKey | AWWGHWDARIQIFJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |