C14H18Cl2N4O4 — CID 595726
5-(diaminomethylideneamino)-2-[[2-(2,4-dichlorophenoxy)acetyl]amino]pentanoic acid (PubChem CID 595726) has the molecular formula C14H18Cl2N4O4 and a molecular weight of 377.23 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[[2-(2,4-dichlorophenoxy)acetyl]amino]pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-[[2-(2,4-dichlorophenoxy)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 595726 |
| Molecular Formula | C14H18Cl2N4O4 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[[2-(2,4-dichlorophenoxy)acetyl]amino]pentanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)COc1ccc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C14H18Cl2N4O4/c15-8-3-4-11(9(16)6-8)24-7-12(21)20-10(13(22)23)2-1-5-19-14(17)18/h3-4,6,10H,1-2,5,7H2,(H,20,21)(H,22,23)(H4,17,18,19) |
| InChIKey | JRWNOSHBJCGDHD-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|