C26H32Cl4N6O4 — CID 58807359
5-(diaminomethylideneamino)-2-[[2-[2-(2,4-dichlorophenyl)ethyl-[2-[2-(2,4-dichlorophenyl)ethylamino]acetyl]amino]acetyl]amino]pentanoic acid (PubChem CID 58807359) has the molecular formula C26H32Cl4N6O4 and a molecular weight of 634.39 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[[2-[2-(2,4-dichlorophenyl)ethyl-[2-[2-(2,4-dichlorophenyl)ethylamino]acetyl]amino]acetyl]amino]pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-[[2-[2-(2,4-dichlorophenyl)ethyl-[2-[2-(2,4-dichlorophenyl)ethylamino]acetyl]amino]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 58807359 |
| Molecular Formula | C26H32Cl4N6O4 |
| Molecular Weight | 634.39 g/mol |
| Exact Mass | 632.12 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[[2-[2-(2,4-dichlorophenyl)ethyl-[2-[2-(2,4-dichlorophenyl)ethylamino]acetyl]amino]acetyl]amino]pentanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)CN(CCc1ccc(Cl)cc1Cl)C(=O)CNCCc1ccc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C26H32Cl4N6O4/c27-18-5-3-16(20(29)12-18)7-10-33-14-24(38)36(11-8-17-4-6-19(28)13-21(17)30)15-23(37)35-22(25(39)40)2-1-9-34-26(31)32/h3-6,12-13,22,33H,1-2,7-11,14-15H2,(H,35,37)(H,39,40)(H4,31,32,34) |
| InChIKey | XMXGNXQYPQBFGP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 163.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|