C17H26N6O5 — CID 71661078
(2S)-2-[[2-(N-[(2R)-2-amino-3-hydroxypropanoyl]anilino)acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 71661078) has the molecular formula C17H26N6O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is (2S)-2-[[2-(N-[(2R)-2-amino-3-hydroxypropanoyl]anilino)acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[2-(N-[(2R)-2-amino-3-hydroxypropanoyl]anilino)acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 71661078 |
| Molecular Formula | C17H26N6O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | (2S)-2-[[2-(N-[(2R)-2-amino-3-hydroxypropanoyl]anilino)acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)CN(C(=O)[C@H](N)CO)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H26N6O5/c18-12(10-24)15(26)23(11-5-2-1-3-6-11)9-14(25)22-13(16(27)28)7-4-8-21-17(19)20/h1-3,5-6,12-13,24H,4,7-10,18H2,(H,22,25)(H,27,28)(H4,19,20,21)/t12-,13+/m1/s1 |
| InChIKey | KOWREVYAIUCGFS-OLZOCXBDSA-N |
| XLogP | -2.04 |
| TPSA | 197.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|