C20H35N7O11 — CID 98616664
(2R)-2-[[2-[2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 98616664) has the molecular formula C20H35N7O11 and a molecular weight of 549.54 g/mol. Its IUPAC name is (2R)-2-[[2-[2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2R)-2-[[2-[2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 98616664 |
| Molecular Formula | C20H35N7O11 |
| Molecular Weight | 549.54 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | (2R)-2-[[2-[2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCC[C@@H](NC(=O)CN(CCN(CCN(CC(=O)O)CC(=O)O)CC(=O)O)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H35N7O11/c21-20(22)23-3-1-2-13(19(37)38)24-14(28)8-26(10-16(31)32)6-4-25(9-15(29)30)5-7-27(11-17(33)34)12-18(35)36/h13H,1-12H2,(H,24,28)(H,29,30)(H,31,32)(H,33,34)(H,35,36)(H,37,38)(H4,21,22,23)/t13-/m1/s1 |
| InChIKey | DFHWVYAOUDFXTD-CYBMUJFWSA-N |
| XLogP | -4.15 |
| TPSA | 289.72 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.54 |
| LogP ≤ 5 | -4.15 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|