C14H32N8O4 — CID 161367274
(2R)-5-(diaminomethylideneamino)-2-(methylamino)pentanoic acid (PubChem CID 161367274) has the molecular formula C14H32N8O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-2-(methylamino)pentanoic acid.
| Compound Name | (2R)-5-(diaminomethylideneamino)-2-(methylamino)pentanoic acid |
|---|---|
| PubChem CID | 161367274 |
| Molecular Formula | C14H32N8O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-2-(methylamino)pentanoic acid |
| SMILES | CN[C@H](CCCN=C(N)N)C(=O)O.CN[C@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/2C7H16N4O2/c2*1-10-5(6(12)13)3-2-4-11-7(8)9/h2*5,10H,2-4H2,1H3,(H,12,13)(H4,8,9,11)/t2*5-/m11/s1 |
| InChIKey | VPZCEPWZYVGUCQ-BXXIVHCWSA-N |
| XLogP | -2.57 |
| TPSA | 227.46 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|