C9H20N4O4 — CID 57329063
(2R)-5-(diaminomethylideneamino)-2-[[(2S)-1,1-dihydroxypropan-2-yl]amino]pentanoic acid (PubChem CID 57329063) has the molecular formula C9H20N4O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-2-[[(2S)-1,1-dihydroxypropan-2-yl]amino]pentanoic acid.
| Compound Name | (2R)-5-(diaminomethylideneamino)-2-[[(2S)-1,1-dihydroxypropan-2-yl]amino]pentanoic acid |
|---|---|
| PubChem CID | 57329063 |
| Molecular Formula | C9H20N4O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-2-[[(2S)-1,1-dihydroxypropan-2-yl]amino]pentanoic acid |
| SMILES | C[C@H](N[C@H](CCCN=C(N)N)C(=O)O)C(O)O |
| InChI | InChI=1S/C9H20N4O4/c1-5(7(14)15)13-6(8(16)17)3-2-4-12-9(10)11/h5-7,13-15H,2-4H2,1H3,(H,16,17)(H4,10,11,12)/t5-,6+/m0/s1 |
| InChIKey | GZLAPPVQKYYOHM-NTSWFWBYSA-N |
| XLogP | -2.22 |
| TPSA | 154.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|