C7H15FN4O2 — CID 88629347
5-(diaminomethylideneamino)-2-(fluoromethylamino)pentanoic acid (PubChem CID 88629347) has the molecular formula C7H15FN4O2 and a molecular weight of 206.22 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-(fluoromethylamino)pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-(fluoromethylamino)pentanoic acid |
|---|---|
| PubChem CID | 88629347 |
| Molecular Formula | C7H15FN4O2 |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-(fluoromethylamino)pentanoic acid |
| SMILES | NC(N)=NCCCC(NCF)C(=O)O |
| InChI | InChI=1S/C7H15FN4O2/c8-4-12-5(6(13)14)2-1-3-11-7(9)10/h5,12H,1-4H2,(H,13,14)(H4,9,10,11) |
| InChIKey | ZSOMKTOYRKMTJS-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|