C7H17ClN4O2 — CID 23193375
5-(diaminomethylideneamino)-2-(methylamino)pentanoic acid;hydrochloride (PubChem CID 23193375) has the molecular formula C7H17ClN4O2 and a molecular weight of 224.69 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-(methylamino)pentanoic acid;hydrochloride.
| Compound Name | 5-(diaminomethylideneamino)-2-(methylamino)pentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 23193375 |
| Molecular Formula | C7H17ClN4O2 |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-(methylamino)pentanoic acid;hydrochloride |
| SMILES | CNC(CCCN=C(N)N)C(=O)O.Cl |
| InChI | InChI=1S/C7H16N4O2.ClH/c1-10-5(6(12)13)3-2-4-11-7(8)9;/h5,10H,2-4H2,1H3,(H,12,13)(H4,8,9,11);1H |
| InChIKey | YBUBNGCCLWQUHK-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|