C8H17N5O4 — CID 173073203
(2S)-2-[[amino(carboxy)methyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 173073203) has the molecular formula C8H17N5O4 and a molecular weight of 247.25 g/mol. Its IUPAC name is (2S)-2-[[amino(carboxy)methyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[amino(carboxy)methyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 173073203 |
| Molecular Formula | C8H17N5O4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | (2S)-2-[[amino(carboxy)methyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H17N5O4/c9-5(7(16)17)13-4(6(14)15)2-1-3-12-8(10)11/h4-5,13H,1-3,9H2,(H,14,15)(H,16,17)(H4,10,11,12)/t4-,5?/m0/s1 |
| InChIKey | JDOWTPVTYZTVFR-ROLXFIACSA-N |
| XLogP | -2.55 |
| TPSA | 177.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|