C14H22N4O3 — CID 70140181
(2S)-5-(diaminomethylideneamino)-2-[1-(4-hydroxyphenyl)ethylamino]pentanoic acid (PubChem CID 70140181) has the molecular formula C14H22N4O3 and a molecular weight of 294.36 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[1-(4-hydroxyphenyl)ethylamino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[1-(4-hydroxyphenyl)ethylamino]pentanoic acid |
|---|---|
| PubChem CID | 70140181 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[1-(4-hydroxyphenyl)ethylamino]pentanoic acid |
| SMILES | CC(N[C@@H](CCCN=C(N)N)C(=O)O)c1ccc(O)cc1 |
| InChI | InChI=1S/C14H22N4O3/c1-9(10-4-6-11(19)7-5-10)18-12(13(20)21)3-2-8-17-14(15)16/h4-7,9,12,18-19H,2-3,8H2,1H3,(H,20,21)(H4,15,16,17)/t9?,12-/m0/s1 |
| InChIKey | ZZUQNQGAVQREHT-ACGXKRRESA-N |
| XLogP | 0.55 |
| TPSA | 133.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|