C30H35N5O6 — CID 70140048
benzyl N-[N'-[(4R)-5-amino-4-[[(1R)-1-(4-hydroxyphenyl)ethyl]amino]-5-oxopentyl]-N-phenylmethoxycarbonylcarbamimidoyl]carbamate (PubChem CID 70140048) has the molecular formula C30H35N5O6 and a molecular weight of 561.64 g/mol. Its IUPAC name is benzyl N-[N'-[(4R)-5-amino-4-[[(1R)-1-(4-hydroxyphenyl)ethyl]amino]-5-oxopentyl]-N-phenylmethoxycarbonylcarbamimidoyl]carbamate.
| Compound Name | benzyl N-[N'-[(4R)-5-amino-4-[[(1R)-1-(4-hydroxyphenyl)ethyl]amino]-5-oxopentyl]-N-phenylmethoxycarbonylcarbamimidoyl]carbamate |
|---|---|
| PubChem CID | 70140048 |
| Molecular Formula | C30H35N5O6 |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.26 |
| IUPAC Name | benzyl N-[N'-[(4R)-5-amino-4-[[(1R)-1-(4-hydroxyphenyl)ethyl]amino]-5-oxopentyl]-N-phenylmethoxycarbonylcarbamimidoyl]carbamate |
| SMILES | C[C@@H](N[C@H](CCCN=C(NC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1)C(N)=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C30H35N5O6/c1-21(24-14-16-25(36)17-15-24)33-26(27(31)37)13-8-18-32-28(34-29(38)40-19-22-9-4-2-5-10-22)35-30(39)41-20-23-11-6-3-7-12-23/h2-7,9-12,14-17,21,26,33,36H,8,13,18-20H2,1H3,(H2,31,37)(H2,32,34,35,38,39)/t21-,26-/m1/s1 |
| InChIKey | SADGBHIORQYDOZ-QFQXNSOFSA-N |
| XLogP | 3.89 |
| TPSA | 164.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|